About N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide
N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide (PubChem CID 2883212) has the molecular formula C16H16N2O3
and a molecular weight of 284.31 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide.
Molecular Properties
| Compound Name | N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide |
| PubChem CID | 2883212 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide |
| SMILES | O=C(NCC(O)c1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H16N2O3/c19-14(12-7-3-1-4-8-12)11-17-15(20)16(21)18-13-9-5-2-6-10-13/h1-10,14,19H,11H2,(H,17,20)(H,18,21) |
| InChIKey | WFJMVNINHWUHKT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide?
The IUPAC name of N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide (CID 2883212) is N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide.
What is the SMILES notation for N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide?
The canonical SMILES for N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide is O=C(NCC(O)c1ccccc1)C(=O)Nc1ccccc1.
What is the InChIKey of N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide?
The InChIKey is WFJMVNINHWUHKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3/c19-14(12-7-3-1-4-8-12)11-17-15(20)16(21)18-13-9-5-2-6-10-13/h1-10,14,19H,11H2,(H,17,20)(H,18,21).
What are the key properties of N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide?
N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide has a molecular weight of 284.31 g/mol, XLogP of 1.47, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxy-2-phenylethyl)-N'-phenyloxamide is sourced from PubChem (CID 2883212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).