About N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide
N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide (PubChem CID 2883263) has the molecular formula C15H20N2O3
and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide.
Molecular Properties
| Compound Name | N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide |
| PubChem CID | 2883263 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide |
| SMILES | CC(NC(=O)C(=O)NCC1CCCO1)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O3/c1-11(12-6-3-2-4-7-12)17-15(19)14(18)16-10-13-8-5-9-20-13/h2-4,6-7,11,13H,5,8-10H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | OAHMFRBSTLXJCN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide?
The IUPAC name of N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide (CID 2883263) is N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide.
What is the SMILES notation for N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide?
The canonical SMILES for N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide is CC(NC(=O)C(=O)NCC1CCCO1)c1ccccc1.
What is the InChIKey of N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide?
The InChIKey is OAHMFRBSTLXJCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-11(12-6-3-2-4-7-12)17-15(19)14(18)16-10-13-8-5-9-20-13/h2-4,6-7,11,13H,5,8-10H2,1H3,(H,16,18)(H,17,19).
What are the key properties of N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide?
N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide has a molecular weight of 276.34 g/mol, XLogP of 1.16, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxolan-2-ylmethyl)-N'-(1-phenylethyl)oxamide is sourced from PubChem (CID 2883263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).