About 2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide
2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide (PubChem CID 2883350) has the molecular formula C19H10ClF2NO2
and a molecular weight of 357.74 g/mol. Its IUPAC name is 2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide.
Molecular Properties
| Compound Name | 2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide |
| PubChem CID | 2883350 |
| Molecular Formula | C19H10ClF2NO2 |
| Molecular Weight | 357.74 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)oc1ccccc12)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C19H10ClF2NO2/c20-14-9-16(22)15(21)8-13(14)19(24)23-10-5-6-12-11-3-1-2-4-17(11)25-18(12)7-10/h1-9H,(H,23,24) |
| InChIKey | JBAJOIJIEBAEEB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.74 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide?
The IUPAC name of 2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide (CID 2883350) is 2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide.
What is the SMILES notation for 2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide?
The canonical SMILES for 2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide is O=C(Nc1ccc2c(c1)oc1ccccc12)c1cc(F)c(F)cc1Cl.
What is the InChIKey of 2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide?
The InChIKey is JBAJOIJIEBAEEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H10ClF2NO2/c20-14-9-16(22)15(21)8-13(14)19(24)23-10-5-6-12-11-3-1-2-4-17(11)25-18(12)7-10/h1-9H,(H,23,24).
What are the key properties of 2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide?
2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide has a molecular weight of 357.74 g/mol, XLogP of 5.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-dibenzofuran-3-yl-4,5-difluorobenzamide is sourced from PubChem (CID 2883350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).