C26H29ClN2O7 — CID 28836318
(5R)-4-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 28836318) has the molecular formula C26H29ClN2O7 and a molecular weight of 516.98 g/mol. Its IUPAC name is (5R)-4-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 28836318 |
| Molecular Formula | C26H29ClN2O7 |
| Molecular Weight | 516.98 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | (5R)-4-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-5-(3,4-dimethoxyphenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc([C@@H]2C(=C(O)c3cc(Cl)ccc3O)C(=O)C(=O)N2CCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C26H29ClN2O7/c1-34-20-7-4-16(14-21(20)35-2)23-22(24(31)18-15-17(27)5-6-19(18)30)25(32)26(33)29(23)9-3-8-28-10-12-36-13-11-28/h4-7,14-15,23,30-31H,3,8-13H2,1-2H3/t23-/m1/s1 |
| InChIKey | PGWZUXSKUBAHLQ-HSZRJFAPSA-N |
| XLogP | 3.21 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.98 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|