C23H23ClN2O6 — CID 28836498
methyl 4-[(2S)-3-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 28836498) has the molecular formula C23H23ClN2O6 and a molecular weight of 458.90 g/mol. Its IUPAC name is methyl 4-[(2S)-3-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S)-3-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 28836498 |
| Molecular Formula | C23H23ClN2O6 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | methyl 4-[(2S)-3-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C(=C(O)c3cc(Cl)ccc3O)C(=O)C(=O)N2CCN(C)C)cc1 |
| InChI | InChI=1S/C23H23ClN2O6/c1-25(2)10-11-26-19(13-4-6-14(7-5-13)23(31)32-3)18(21(29)22(26)30)20(28)16-12-15(24)8-9-17(16)27/h4-9,12,19,27-28H,10-11H2,1-3H3/t19-/m0/s1 |
| InChIKey | DUMCYIYLZIGZOL-IBGZPJMESA-N |
| XLogP | 2.82 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|