About 6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid
6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 2883747) has the molecular formula C16H19NO3
and a molecular weight of 273.33 g/mol. Its IUPAC name is 6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| PubChem CID | 2883747 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1ccc(C)c(NC(=O)C2CC=CCC2C(=O)O)c1 |
| InChI | InChI=1S/C16H19NO3/c1-10-7-8-11(2)14(9-10)17-15(18)12-5-3-4-6-13(12)16(19)20/h3-4,7-9,12-13H,5-6H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | JKNZNZPXDDOWOY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid?
The IUPAC name of 6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (CID 2883747) is 6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
What is the SMILES notation for 6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid?
The canonical SMILES for 6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid is Cc1ccc(C)c(NC(=O)C2CC=CCC2C(=O)O)c1.
What is the InChIKey of 6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid?
The InChIKey is JKNZNZPXDDOWOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3/c1-10-7-8-11(2)14(9-10)17-15(18)12-5-3-4-6-13(12)16(19)20/h3-4,7-9,12-13H,5-6H2,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid?
6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid has a molecular weight of 273.33 g/mol, XLogP of 2.91, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,5-dimethylphenyl)carbamoyl]cyclohex-3-ene-1-carboxylic acid is sourced from PubChem (CID 2883747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).