C26H21ClN2O2 — CID 2883845
2-benzoyl-6-(2-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 2883845) has the molecular formula C26H21ClN2O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is 2-benzoyl-6-(2-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 2-benzoyl-6-(2-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 2883845 |
| Molecular Formula | C26H21ClN2O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-benzoyl-6-(2-chlorophenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1CCCC2=C1C(c1ccccc1Cl)Nc1ccc(C(=O)c3ccccc3)cc1N2 |
| InChI | InChI=1S/C26H21ClN2O2/c27-19-10-5-4-9-18(19)25-24-21(11-6-12-23(24)30)28-22-15-17(13-14-20(22)29-25)26(31)16-7-2-1-3-8-16/h1-5,7-10,13-15,25,28-29H,6,11-12H2 |
| InChIKey | AHGQKEJUFHKILQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |