C21H23ClN2O6 — CID 28840535
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] (2S)-2-[(1S,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate (PubChem CID 28840535) has the molecular formula C21H23ClN2O6 and a molecular weight of 434.88 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] (2S)-2-[(1S,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] (2S)-2-[(1S,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate |
|---|---|
| PubChem CID | 28840535 |
| Molecular Formula | C21H23ClN2O6 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] (2S)-2-[(1S,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]propanoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)COC(=O)[C@H](C)N1C(=O)[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]2C1=O |
| InChI | InChI=1S/C21H23ClN2O6/c1-10(24-19(26)17-11-3-4-12(7-11)18(17)20(24)27)21(28)30-9-16(25)23-14-8-13(22)5-6-15(14)29-2/h5-6,8,10-12,17-18H,3-4,7,9H2,1-2H3,(H,23,25)/t10-,11-,12+,17-,18-/m0/s1 |
| InChIKey | GPYWZWZCCUUMRU-FOXVFAIDSA-N |
| XLogP | 2.25 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|