About [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone
[(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone (PubChem CID 28842887) has the molecular formula C12H18Cl2N2O
and a molecular weight of 277.19 g/mol. Its IUPAC name is [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone |
| PubChem CID | 28842887 |
| Molecular Formula | C12H18Cl2N2O |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone |
| SMILES | C=CCN1CCN(C(=O)[C@]2(C)CC2(Cl)Cl)CC1 |
| InChI | InChI=1S/C12H18Cl2N2O/c1-3-4-15-5-7-16(8-6-15)10(17)11(2)9-12(11,13)14/h3H,1,4-9H2,2H3/t11-/m0/s1 |
| InChIKey | JLYVAVNFBVRRIM-NSHDSACASA-N |
| XLogP | 1.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone?
The IUPAC name of [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone (CID 28842887) is [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone.
What is the SMILES notation for [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone?
The canonical SMILES for [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone is C=CCN1CCN(C(=O)[C@]2(C)CC2(Cl)Cl)CC1.
What is the InChIKey of [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone?
The InChIKey is JLYVAVNFBVRRIM-NSHDSACASA-N. The full InChI is InChI=1S/C12H18Cl2N2O/c1-3-4-15-5-7-16(8-6-15)10(17)11(2)9-12(11,13)14/h3H,1,4-9H2,2H3/t11-/m0/s1.
What are the key properties of [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone?
[(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone has a molecular weight of 277.19 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2,2-dichloro-1-methylcyclopropyl]-(4-prop-2-enylpiperazin-1-yl)methanone is sourced from PubChem (CID 28842887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).