C32H30F3N5O3 — CID 2884383
(4-benzhydrylpiperazin-1-yl)-[5-(1,3-benzodioxol-5-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone (PubChem CID 2884383) has the molecular formula C32H30F3N5O3 and a molecular weight of 589.62 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[5-(1,3-benzodioxol-5-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[5-(1,3-benzodioxol-5-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
|---|---|
| PubChem CID | 2884383 |
| Molecular Formula | C32H30F3N5O3 |
| Molecular Weight | 589.62 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[5-(1,3-benzodioxol-5-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]methanone |
| SMILES | O=C(c1cc2n(n1)C(C(F)(F)F)CC(c1ccc3c(c1)OCO3)N2)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H30F3N5O3/c33-32(34,35)28-18-24(23-11-12-26-27(17-23)43-20-42-26)36-29-19-25(37-40(28)29)31(41)39-15-13-38(14-16-39)30(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-12,17,19,24,28,30,36H,13-16,18,20H2 |
| InChIKey | WIMZUKKDKJOVEK-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |