C23H22ClF3N4O5S2 — CID 2884419
diethyl 5-[[3-chloro-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 2884419) has the molecular formula C23H22ClF3N4O5S2 and a molecular weight of 591.03 g/mol. Its IUPAC name is diethyl 5-[[3-chloro-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[3-chloro-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2884419 |
| Molecular Formula | C23H22ClF3N4O5S2 |
| Molecular Weight | 591.03 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | diethyl 5-[[3-chloro-5-thiophen-2-yl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carbonyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2nn3c(c2Cl)NC(c2cccs2)CC3C(F)(F)F)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C23H22ClF3N4O5S2/c1-4-35-21(33)14-10(3)17(22(34)36-5-2)38-20(14)29-19(32)16-15(24)18-28-11(12-7-6-8-37-12)9-13(23(25,26)27)31(18)30-16/h6-8,11,13,28H,4-5,9H2,1-3H3,(H,29,32) |
| InChIKey | UQGXJZXTNSJLMB-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.03 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |