C15H22N4OS — CID 2884487
5,5-dimethyl-4-(morpholin-4-ylmethyl)-2-phenyl-1,2,4-triazolidine-3-thione (PubChem CID 2884487) has the molecular formula C15H22N4OS and a molecular weight of 306.43 g/mol. Its IUPAC name is 5,5-dimethyl-4-(morpholin-4-ylmethyl)-2-phenyl-1,2,4-triazolidine-3-thione.
| Compound Name | 5,5-dimethyl-4-(morpholin-4-ylmethyl)-2-phenyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 2884487 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 5,5-dimethyl-4-(morpholin-4-ylmethyl)-2-phenyl-1,2,4-triazolidine-3-thione |
| SMILES | CC1(C)NN(c2ccccc2)C(=S)N1CN1CCOCC1 |
| InChI | InChI=1S/C15H22N4OS/c1-15(2)16-19(13-6-4-3-5-7-13)14(21)18(15)12-17-8-10-20-11-9-17/h3-7,16H,8-12H2,1-2H3 |
| InChIKey | YOXQXQYERHQGFO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|