C19H13N3O7S — CID 2884630
methyl 4-[[3-[(4-nitrobenzoyl)amino]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate (PubChem CID 2884630) has the molecular formula C19H13N3O7S and a molecular weight of 427.39 g/mol. Its IUPAC name is methyl 4-[[3-[(4-nitrobenzoyl)amino]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate.
| Compound Name | methyl 4-[[3-[(4-nitrobenzoyl)amino]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 2884630 |
| Molecular Formula | C19H13N3O7S |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | methyl 4-[[3-[(4-nitrobenzoyl)amino]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=C2SC(=O)N(NC(=O)c3ccc([N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H13N3O7S/c1-29-18(25)13-4-2-11(3-5-13)10-15-17(24)21(19(26)30-15)20-16(23)12-6-8-14(9-7-12)22(27)28/h2-10H,1H3,(H,20,23) |
| InChIKey | KOJLOKDFMAAIFX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|