About 4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine
4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine (PubChem CID 28848315) has the molecular formula C19H22N4OS
and a molecular weight of 354.48 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine |
| PubChem CID | 28848315 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine |
| SMILES | COc1ccc(-c2c(C)sc3ncnc(N4CCCNCC4)c23)cc1 |
| InChI | InChI=1S/C19H22N4OS/c1-13-16(14-4-6-15(24-2)7-5-14)17-18(21-12-22-19(17)25-13)23-10-3-8-20-9-11-23/h4-7,12,20H,3,8-11H2,1-2H3 |
| InChIKey | BWOFLDVFZPABJB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine?
The IUPAC name of 4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine (CID 28848315) is 4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine.
What is the SMILES notation for 4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine?
The canonical SMILES for 4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine is COc1ccc(-c2c(C)sc3ncnc(N4CCCNCC4)c23)cc1.
What is the InChIKey of 4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine?
The InChIKey is BWOFLDVFZPABJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4OS/c1-13-16(14-4-6-15(24-2)7-5-14)17-18(21-12-22-19(17)25-13)23-10-3-8-20-9-11-23/h4-7,12,20H,3,8-11H2,1-2H3.
What are the key properties of 4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine?
4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine has a molecular weight of 354.48 g/mol, XLogP of 3.48, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-diazepan-1-yl)-5-(4-methoxyphenyl)-6-methylthieno[2,3-d]pyrimidine is sourced from PubChem (CID 28848315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).