C19H18N2O3 — CID 2885026
N-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-2-phenylacetamide (PubChem CID 2885026) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is N-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-2-phenylacetamide.
| Compound Name | N-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 2885026 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NN1C(=O)C2C3C=CC(C4CC34)C2C1=O |
| InChI | InChI=1S/C19H18N2O3/c22-15(8-10-4-2-1-3-5-10)20-21-18(23)16-11-6-7-12(14-9-13(11)14)17(16)19(21)24/h1-7,11-14,16-17H,8-9H2,(H,20,22) |
| InChIKey | MSJDEALLCYFPIJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|