C20H29IN2O2 — CID 2885073
1-(cyclohex-3-en-1-ylmethoxy)-3-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)propan-2-ol iodide (PubChem CID 2885073) has the molecular formula C20H29IN2O2 and a molecular weight of 456.37 g/mol. Its IUPAC name is 1-(cyclohex-3-en-1-ylmethoxy)-3-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)propan-2-ol iodide.
| Compound Name | 1-(cyclohex-3-en-1-ylmethoxy)-3-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)propan-2-ol iodide |
|---|---|
| PubChem CID | 2885073 |
| Molecular Formula | C20H29IN2O2 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 1-(cyclohex-3-en-1-ylmethoxy)-3-(3,5,6-trimethylbenzimidazol-3-ium-1-yl)propan-2-ol iodide |
| SMILES | Cc1cc2c(cc1C)[n+](C)cn2CC(O)COCC1CC=CCC1.[I-] |
| InChI | InChI=1S/C20H29N2O2.HI/c1-15-9-19-20(10-16(15)2)22(14-21(19)3)11-18(23)13-24-12-17-7-5-4-6-8-17;/h4-5,9-10,14,17-18,23H,6-8,11-13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | XQFPNGHKCLMWQI-UHFFFAOYSA-M |
| XLogP | -0.18 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|