C15H21N5OS — CID 28854595
[4-[[4-(methylaminomethyl)triazol-1-yl]methyl]piperidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 28854595) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is [4-[[4-(methylaminomethyl)triazol-1-yl]methyl]piperidin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [4-[[4-(methylaminomethyl)triazol-1-yl]methyl]piperidin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 28854595 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | [4-[[4-(methylaminomethyl)triazol-1-yl]methyl]piperidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | CNCc1cn(CC2CCN(C(=O)c3ccsc3)CC2)nn1 |
| InChI | InChI=1S/C15H21N5OS/c1-16-8-14-10-20(18-17-14)9-12-2-5-19(6-3-12)15(21)13-4-7-22-11-13/h4,7,10-12,16H,2-3,5-6,8-9H2,1H3 |
| InChIKey | BHAFDOCLXOONHP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |