C11H20O3Si3 — CID 28856
2,2,4,4,6-pentamethyl-6-phenyl-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 28856) has the molecular formula C11H20O3Si3 and a molecular weight of 284.54 g/mol. Its IUPAC name is 2,2,4,4,6-pentamethyl-6-phenyl-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,2,4,4,6-pentamethyl-6-phenyl-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 28856 |
| Molecular Formula | C11H20O3Si3 |
| Molecular Weight | 284.54 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 2,2,4,4,6-pentamethyl-6-phenyl-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(c2ccccc2)O1 |
| InChI | InChI=1S/C11H20O3Si3/c1-15(2)12-16(3,4)14-17(5,13-15)11-9-7-6-8-10-11/h6-10H,1-5H3 |
| InChIKey | JITAAWJDVCUJPO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|