C15H18N2O3S — CID 28857021
ethyl 3-[4-(2-amino-5-methyl-1,3-thiazol-4-yl)phenoxy]propanoate (PubChem CID 28857021) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is ethyl 3-[4-(2-amino-5-methyl-1,3-thiazol-4-yl)phenoxy]propanoate.
| Compound Name | ethyl 3-[4-(2-amino-5-methyl-1,3-thiazol-4-yl)phenoxy]propanoate |
|---|---|
| PubChem CID | 28857021 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | ethyl 3-[4-(2-amino-5-methyl-1,3-thiazol-4-yl)phenoxy]propanoate |
| SMILES | CCOC(=O)CCOc1ccc(-c2nc(N)sc2C)cc1 |
| InChI | InChI=1S/C15H18N2O3S/c1-3-19-13(18)8-9-20-12-6-4-11(5-7-12)14-10(2)21-15(16)17-14/h4-7H,3,8-9H2,1-2H3,(H2,16,17) |
| InChIKey | IEJDKZNPJJZKFU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |