C19H27IN2O2 — CID 2885719
1-(cyclohex-3-en-1-ylmethoxy)-3-(2,3-dimethylbenzimidazol-3-ium-1-yl)propan-2-ol iodide (PubChem CID 2885719) has the molecular formula C19H27IN2O2 and a molecular weight of 442.34 g/mol. Its IUPAC name is 1-(cyclohex-3-en-1-ylmethoxy)-3-(2,3-dimethylbenzimidazol-3-ium-1-yl)propan-2-ol iodide.
| Compound Name | 1-(cyclohex-3-en-1-ylmethoxy)-3-(2,3-dimethylbenzimidazol-3-ium-1-yl)propan-2-ol iodide |
|---|---|
| PubChem CID | 2885719 |
| Molecular Formula | C19H27IN2O2 |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 1-(cyclohex-3-en-1-ylmethoxy)-3-(2,3-dimethylbenzimidazol-3-ium-1-yl)propan-2-ol iodide |
| SMILES | Cc1n(CC(O)COCC2CC=CCC2)c2ccccc2[n+]1C.[I-] |
| InChI | InChI=1S/C19H27N2O2.HI/c1-15-20(2)18-10-6-7-11-19(18)21(15)12-17(22)14-23-13-16-8-4-3-5-9-16;/h3-4,6-7,10-11,16-17,22H,5,8-9,12-14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | OTDUNWWLBVQAIX-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 38.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|