C14H12BrNO4S2 — CID 2885740
[2-bromo-6-ethoxy-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] acetate (PubChem CID 2885740) has the molecular formula C14H12BrNO4S2 and a molecular weight of 402.29 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] acetate.
| Compound Name | [2-bromo-6-ethoxy-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 2885740 |
| Molecular Formula | C14H12BrNO4S2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 400.94 |
| IUPAC Name | [2-bromo-6-ethoxy-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] acetate |
| SMILES | CCOc1cc(C=C2SC(=S)NC2=O)cc(Br)c1OC(C)=O |
| InChI | InChI=1S/C14H12BrNO4S2/c1-3-19-10-5-8(4-9(15)12(10)20-7(2)17)6-11-13(18)16-14(21)22-11/h4-6H,3H2,1-2H3,(H,16,18,21) |
| InChIKey | KUOUMXXCYXPOCX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|