C20H30N6O2S — CID 2885878
2-[[4,6-bis(diethylamino)-1,3,5-triazin-2-yl]sulfanyl]ethyl N-phenylcarbamate (PubChem CID 2885878) has the molecular formula C20H30N6O2S and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-[[4,6-bis(diethylamino)-1,3,5-triazin-2-yl]sulfanyl]ethyl N-phenylcarbamate.
| Compound Name | 2-[[4,6-bis(diethylamino)-1,3,5-triazin-2-yl]sulfanyl]ethyl N-phenylcarbamate |
|---|---|
| PubChem CID | 2885878 |
| Molecular Formula | C20H30N6O2S |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2-[[4,6-bis(diethylamino)-1,3,5-triazin-2-yl]sulfanyl]ethyl N-phenylcarbamate |
| SMILES | CCN(CC)c1nc(SCCOC(=O)Nc2ccccc2)nc(N(CC)CC)n1 |
| InChI | InChI=1S/C20H30N6O2S/c1-5-25(6-2)17-22-18(26(7-3)8-4)24-19(23-17)29-15-14-28-20(27)21-16-12-10-9-11-13-16/h9-13H,5-8,14-15H2,1-4H3,(H,21,27) |
| InChIKey | MFZJWDIBTMJVQW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|