C15H15N3O2S4 — CID 2886210
N-(4,5-dihydro-1,3-thiazol-2-yl)-4-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide (PubChem CID 2886210) has the molecular formula C15H15N3O2S4 and a molecular weight of 397.57 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-4-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-4-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 2886210 |
| Molecular Formula | C15H15N3O2S4 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-4-[4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanamide |
| SMILES | O=C(CCCN1C(=O)C(=Cc2cccs2)SC1=S)NC1=NCCS1 |
| InChI | InChI=1S/C15H15N3O2S4/c19-12(17-14-16-5-8-23-14)4-1-6-18-13(20)11(24-15(18)21)9-10-3-2-7-22-10/h2-3,7,9H,1,4-6,8H2,(H,16,17,19) |
| InChIKey | MPJLTJBHMPGCOR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|