C15H12N2O2 — CID 28862933
(2E)-6-amino-2-benzylidene-4H-1,4-benzoxazin-3-one (PubChem CID 28862933) has the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. Its IUPAC name is (2E)-6-amino-2-benzylidene-4H-1,4-benzoxazin-3-one.
| Compound Name | (2E)-6-amino-2-benzylidene-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28862933 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (2E)-6-amino-2-benzylidene-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1ccc2c(c1)NC(=O)/C(=C\c1ccccc1)O2 |
| InChI | InChI=1S/C15H12N2O2/c16-11-6-7-13-12(9-11)17-15(18)14(19-13)8-10-4-2-1-3-5-10/h1-9H,16H2,(H,17,18)/b14-8+ |
| InChIKey | SHGNRTOUMIFVQQ-RIYZIHGNSA-N |
| XLogP | 2.64 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|