About (2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one
(2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one (PubChem CID 28863048) has the molecular formula C19H20N2O2
and a molecular weight of 308.38 g/mol. Its IUPAC name is (2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | (2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one |
| PubChem CID | 28863048 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one |
| SMILES | CCCCN1C(=O)/C(=C\c2ccccc2)Oc2ccc(N)cc21 |
| InChI | InChI=1S/C19H20N2O2/c1-2-3-11-21-16-13-15(20)9-10-17(16)23-18(19(21)22)12-14-7-5-4-6-8-14/h4-10,12-13H,2-3,11,20H2,1H3/b18-12+ |
| InChIKey | AYUJFLOLSWPMGD-LDADJPATSA-N |
| XLogP | 3.84 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one?
The IUPAC name of (2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one (CID 28863048) is (2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one.
What is the SMILES notation for (2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one?
The canonical SMILES for (2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one is CCCCN1C(=O)/C(=C\c2ccccc2)Oc2ccc(N)cc21.
What is the InChIKey of (2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one?
The InChIKey is AYUJFLOLSWPMGD-LDADJPATSA-N. The full InChI is InChI=1S/C19H20N2O2/c1-2-3-11-21-16-13-15(20)9-10-17(16)23-18(19(21)22)12-14-7-5-4-6-8-14/h4-10,12-13H,2-3,11,20H2,1H3/b18-12+.
What are the key properties of (2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one?
(2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one has a molecular weight of 308.38 g/mol, XLogP of 3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-6-amino-2-benzylidene-4-butyl-1,4-benzoxazin-3-one is sourced from PubChem (CID 28863048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).