C19H15N3O2S — CID 28863156
(2E)-6-(2-amino-1,3-thiazol-4-yl)-2-[(4-methylphenyl)methylidene]-4H-1,4-benzoxazin-3-one (PubChem CID 28863156) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is (2E)-6-(2-amino-1,3-thiazol-4-yl)-2-[(4-methylphenyl)methylidene]-4H-1,4-benzoxazin-3-one.
| Compound Name | (2E)-6-(2-amino-1,3-thiazol-4-yl)-2-[(4-methylphenyl)methylidene]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28863156 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (2E)-6-(2-amino-1,3-thiazol-4-yl)-2-[(4-methylphenyl)methylidene]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(/C=C2/Oc3ccc(-c4csc(N)n4)cc3NC2=O)cc1 |
| InChI | InChI=1S/C19H15N3O2S/c1-11-2-4-12(5-3-11)8-17-18(23)21-14-9-13(6-7-16(14)24-17)15-10-25-19(20)22-15/h2-10H,1H3,(H2,20,22)(H,21,23)/b17-8+ |
| InChIKey | XDHDNPWPVVYZOF-CAOOACKPSA-N |
| XLogP | 4.07 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|