C15H16N2O4S — CID 28864738
2-[3-[2-(2-methylpropanoylamino)-1,3-thiazol-4-yl]phenoxy]acetic acid (PubChem CID 28864738) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-[3-[2-(2-methylpropanoylamino)-1,3-thiazol-4-yl]phenoxy]acetic acid.
| Compound Name | 2-[3-[2-(2-methylpropanoylamino)-1,3-thiazol-4-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 28864738 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-[3-[2-(2-methylpropanoylamino)-1,3-thiazol-4-yl]phenoxy]acetic acid |
| SMILES | CC(C)C(=O)Nc1nc(-c2cccc(OCC(=O)O)c2)cs1 |
| InChI | InChI=1S/C15H16N2O4S/c1-9(2)14(20)17-15-16-12(8-22-15)10-4-3-5-11(6-10)21-7-13(18)19/h3-6,8-9H,7H2,1-2H3,(H,18,19)(H,16,17,20) |
| InChIKey | MZHVERWUOJGOEK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |