About N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride
N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride (PubChem CID 2886635) has the molecular formula C21H26ClNO
and a molecular weight of 343.90 g/mol. Its IUPAC name is N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride.
Molecular Properties
| Compound Name | N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride |
| PubChem CID | 2886635 |
| Molecular Formula | C21H26ClNO |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride |
| SMILES | CCN(CC)CC#CC(OC)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H25NO.ClH/c1-4-22(5-2)18-12-17-21(23-3,19-13-8-6-9-14-19)20-15-10-7-11-16-20;/h6-11,13-16H,4-5,18H2,1-3H3;1H |
| InChIKey | IQMLAJXJRWHPOY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride?
The IUPAC name of N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride (CID 2886635) is N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride.
What is the SMILES notation for N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride?
The canonical SMILES for N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride is CCN(CC)CC#CC(OC)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride?
The InChIKey is IQMLAJXJRWHPOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO.ClH/c1-4-22(5-2)18-12-17-21(23-3,19-13-8-6-9-14-19)20-15-10-7-11-16-20;/h6-11,13-16H,4-5,18H2,1-3H3;1H.
What are the key properties of N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride?
N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride has a molecular weight of 343.90 g/mol, XLogP of 4.34, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4-methoxy-4,4-diphenylbut-2-yn-1-amine;hydrochloride is sourced from PubChem (CID 2886635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).