C17H21N3O5S — CID 28867109
N-(2-amino-4,5-dimethoxyphenyl)-4-(dimethylsulfamoyl)benzamide (PubChem CID 28867109) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-(2-amino-4,5-dimethoxyphenyl)-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-(2-amino-4,5-dimethoxyphenyl)-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 28867109 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-(2-amino-4,5-dimethoxyphenyl)-4-(dimethylsulfamoyl)benzamide |
| SMILES | COc1cc(N)c(NC(=O)c2ccc(S(=O)(=O)N(C)C)cc2)cc1OC |
| InChI | InChI=1S/C17H21N3O5S/c1-20(2)26(22,23)12-7-5-11(6-8-12)17(21)19-14-10-16(25-4)15(24-3)9-13(14)18/h5-10H,18H2,1-4H3,(H,19,21) |
| InChIKey | WKMAMXFPDCZDKG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|