About 5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one
5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 28868538) has the molecular formula C23H21ClN2OS
and a molecular weight of 408.95 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 28868538 |
| Molecular Formula | C23H21ClN2OS |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(-c3ccccc3Cl)[nH]c(=O)c2c1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H21ClN2OS/c1-13-18(14-9-11-15(12-10-14)23(2,3)4)19-21(27)25-20(26-22(19)28-13)16-7-5-6-8-17(16)24/h5-12H,1-4H3,(H,25,26,27) |
| InChIKey | CIIGBOSVYPCLDL-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one (CID 28868538) is 5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one is Cc1sc2nc(-c3ccccc3Cl)[nH]c(=O)c2c1-c1ccc(C(C)(C)C)cc1.
What is the InChIKey of 5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one?
The InChIKey is CIIGBOSVYPCLDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21ClN2OS/c1-13-18(14-9-11-15(12-10-14)23(2,3)4)19-21(27)25-20(26-22(19)28-13)16-7-5-6-8-17(16)24/h5-12H,1-4H3,(H,25,26,27).
What are the key properties of 5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one?
5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one has a molecular weight of 408.95 g/mol, XLogP of 6.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-tert-butylphenyl)-2-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 28868538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).