C18H21N3O3S — CID 28868992
(8S)-8-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 28868992) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is (8S)-8-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | (8S)-8-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 28868992 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (8S)-8-(4-ethoxyphenyl)-3-(2-hydroxyethyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | CCOc1ccc([C@@H]2CC(=O)N3CN(CCO)CSC3=C2C#N)cc1 |
| InChI | InChI=1S/C18H21N3O3S/c1-2-24-14-5-3-13(4-6-14)15-9-17(23)21-11-20(7-8-22)12-25-18(21)16(15)10-19/h3-6,15,22H,2,7-9,11-12H2,1H3/t15-/m0/s1 |
| InChIKey | VYNDJEOJXCAFCG-HNNXBMFYSA-N |
| XLogP | 2.09 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |