C23H23N3OS — CID 28869049
(8R)-8-(4-methylphenyl)-6-oxo-3-[(1S)-1-phenylethyl]-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 28869049) has the molecular formula C23H23N3OS and a molecular weight of 389.52 g/mol. Its IUPAC name is (8R)-8-(4-methylphenyl)-6-oxo-3-[(1S)-1-phenylethyl]-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | (8R)-8-(4-methylphenyl)-6-oxo-3-[(1S)-1-phenylethyl]-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 28869049 |
| Molecular Formula | C23H23N3OS |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (8R)-8-(4-methylphenyl)-6-oxo-3-[(1S)-1-phenylethyl]-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | Cc1ccc([C@H]2CC(=O)N3CN([C@@H](C)c4ccccc4)CSC3=C2C#N)cc1 |
| InChI | InChI=1S/C23H23N3OS/c1-16-8-10-19(11-9-16)20-12-22(27)26-14-25(15-28-23(26)21(20)13-24)17(2)18-6-4-3-5-7-18/h3-11,17,20H,12,14-15H2,1-2H3/t17-,20+/m0/s1 |
| InChIKey | HHDBAMGZJYSNFS-FXAWDEMLSA-N |
| XLogP | 4.77 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |