C16H11Cl5N4O3S — CID 2887208
3-nitro-N-[2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 2887208) has the molecular formula C16H11Cl5N4O3S and a molecular weight of 516.62 g/mol. Its IUPAC name is 3-nitro-N-[2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 3-nitro-N-[2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 2887208 |
| Molecular Formula | C16H11Cl5N4O3S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 513.90 |
| IUPAC Name | 3-nitro-N-[2,2,2-trichloro-1-[(2,6-dichlorophenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | O=C(NC(NC(=S)Nc1c(Cl)cccc1Cl)C(Cl)(Cl)Cl)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11Cl5N4O3S/c17-10-5-2-6-11(18)12(10)22-15(29)24-14(16(19,20)21)23-13(26)8-3-1-4-9(7-8)25(27)28/h1-7,14H,(H,23,26)(H2,22,24,29) |
| InChIKey | NCMALUNQCSBLMN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|