About 5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid
5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 28875613) has the molecular formula C7H4N2O4
and a molecular weight of 180.12 g/mol. Its IUPAC name is 5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid |
| PubChem CID | 28875613 |
| Molecular Formula | C7H4N2O4 |
| Molecular Weight | 180.12 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid |
| SMILES | O=C(O)c1noc(-c2ccoc2)n1 |
| InChI | InChI=1S/C7H4N2O4/c10-7(11)5-8-6(13-9-5)4-1-2-12-3-4/h1-3H,(H,10,11) |
| InChIKey | HFXDLPQTYUQYJB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.12 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid?
The IUPAC name of 5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid (CID 28875613) is 5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid.
What is the SMILES notation for 5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid?
The canonical SMILES for 5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid is O=C(O)c1noc(-c2ccoc2)n1.
What is the InChIKey of 5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid?
The InChIKey is HFXDLPQTYUQYJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N2O4/c10-7(11)5-8-6(13-9-5)4-1-2-12-3-4/h1-3H,(H,10,11).
What are the key properties of 5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid?
5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid has a molecular weight of 180.12 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-3-yl)-1,2,4-oxadiazole-3-carboxylic acid is sourced from PubChem (CID 28875613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).