C13H14N2O3S — CID 2887565
N-(2,4-dimethylphenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetamide (PubChem CID 2887565) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetamide |
|---|---|
| PubChem CID | 2887565 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetamide |
| SMILES | Cc1ccc(NC(=O)CC2SC(=O)NC2=O)c(C)c1 |
| InChI | InChI=1S/C13H14N2O3S/c1-7-3-4-9(8(2)5-7)14-11(16)6-10-12(17)15-13(18)19-10/h3-5,10H,6H2,1-2H3,(H,14,16)(H,15,17,18) |
| InChIKey | NQSHZUIGMUVMCQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|