6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid

C7H6N2O2S — CID 28875808

IUPAC6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid
SMILESCc1cn2c(C(=O)O)csc2n1
InChIInChI=1S/C7H6N2O2S/c1-4-2-9-5(6(10)11)3-12-7(9)8-4/h2-3H,1H3,(H,10,11)
InChIKeyPEGMBMPPBPZZPS-UHFFFAOYSA-N
MW182.20 g/mol
LogP1.40
Rot. Bonds1

About 6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid

6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid (PubChem CID 28875808) has the molecular formula C7H6N2O2S and a molecular weight of 182.20 g/mol. Its IUPAC name is 6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid.

Molecular Properties

Compound Name6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid
PubChem CID28875808
Molecular FormulaC7H6N2O2S
Molecular Weight182.20 g/mol
Exact Mass182.01
IUPAC Name6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid
SMILESCc1cn2c(C(=O)O)csc2n1
InChIInChI=1S/C7H6N2O2S/c1-4-2-9-5(6(10)11)3-12-7(9)8-4/h2-3H,1H3,(H,10,11)
InChIKeyPEGMBMPPBPZZPS-UHFFFAOYSA-N
XLogP1.40
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.20
LogP ≤ 51.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid?
The IUPAC name of 6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid (CID 28875808) is 6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid.
What is the SMILES notation for 6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid?
The canonical SMILES for 6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid is Cc1cn2c(C(=O)O)csc2n1.
What is the InChIKey of 6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid?
The InChIKey is PEGMBMPPBPZZPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2S/c1-4-2-9-5(6(10)11)3-12-7(9)8-4/h2-3H,1H3,(H,10,11).
What are the key properties of 6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid?
6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid has a molecular weight of 182.20 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylimidazo[2,1-b][1,3]thiazole-3-carboxylic acid is sourced from PubChem (CID 28875808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).