About 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide
2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 28878502) has the molecular formula C7H12N4OS
and a molecular weight of 200.27 g/mol. Its IUPAC name is 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
| PubChem CID | 28878502 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CCCc1n[nH]c(=S)n1CC(N)=O |
| InChI | InChI=1S/C7H12N4OS/c1-2-3-6-9-10-7(13)11(6)4-5(8)12/h2-4H2,1H3,(H2,8,12)(H,10,13) |
| InChIKey | RMIXGNFYIGVLRZ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide?
The IUPAC name of 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide (CID 28878502) is 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide.
What is the SMILES notation for 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide?
The canonical SMILES for 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide is CCCc1n[nH]c(=S)n1CC(N)=O.
What is the InChIKey of 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide?
The InChIKey is RMIXGNFYIGVLRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4OS/c1-2-3-6-9-10-7(13)11(6)4-5(8)12/h2-4H2,1H3,(H2,8,12)(H,10,13).
What are the key properties of 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide?
2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide has a molecular weight of 200.27 g/mol, XLogP of 0.38, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide is sourced from PubChem (CID 28878502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).