C13H9Cl2N3O3 — CID 28880822
3,6-dichloro-N-methyl-N-(4-nitrophenyl)pyridine-2-carboxamide (PubChem CID 28880822) has the molecular formula C13H9Cl2N3O3 and a molecular weight of 326.14 g/mol. Its IUPAC name is 3,6-dichloro-N-methyl-N-(4-nitrophenyl)pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-methyl-N-(4-nitrophenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 28880822 |
| Molecular Formula | C13H9Cl2N3O3 |
| Molecular Weight | 326.14 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 3,6-dichloro-N-methyl-N-(4-nitrophenyl)pyridine-2-carboxamide |
| SMILES | CN(C(=O)c1nc(Cl)ccc1Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9Cl2N3O3/c1-17(8-2-4-9(5-3-8)18(20)21)13(19)12-10(14)6-7-11(15)16-12/h2-7H,1H3 |
| InChIKey | OCXRFVVSQPPSRS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.14 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|