About 2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide
2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 28881169) has the molecular formula C8H14F3N3O
and a molecular weight of 225.21 g/mol. Its IUPAC name is 2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide |
| PubChem CID | 28881169 |
| Molecular Formula | C8H14F3N3O |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CN1CCNCC1)NCC(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O/c9-8(10,11)6-13-7(15)5-14-3-1-12-2-4-14/h12H,1-6H2,(H,13,15) |
| InChIKey | GPGICHPDJMNBMW-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide?
The IUPAC name of 2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide (CID 28881169) is 2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide.
What is the SMILES notation for 2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide?
The canonical SMILES for 2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide is O=C(CN1CCNCC1)NCC(F)(F)F.
What is the InChIKey of 2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide?
The InChIKey is GPGICHPDJMNBMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3N3O/c9-8(10,11)6-13-7(15)5-14-3-1-12-2-4-14/h12H,1-6H2,(H,13,15).
What are the key properties of 2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide?
2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide has a molecular weight of 225.21 g/mol, XLogP of -0.43, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-N-(2,2,2-trifluoroethyl)acetamide is sourced from PubChem (CID 28881169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).