cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid

C4H7NO2 — CID 28881824

IUPACcis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid
SMILESN[C@H]1C[C@H]1C(=O)O
InChIInChI=1S/C4H7NO2/c5-3-1-2(3)4(6)7/h2-3H,1,5H2,(H,6,7)/t2-,3+/m1/s1
InChIKeyLHKAUBTWBDZARW-GBXIJSLDSA-N
MW101.10 g/mol
LogP-0.58
Rot. Bonds1

About cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid

cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid (PubChem CID 28881824) has the molecular formula C4H7NO2 and a molecular weight of 101.10 g/mol. Its IUPAC name is cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid
PubChem CID28881824
Molecular FormulaC4H7NO2
Molecular Weight101.10 g/mol
Exact Mass101.05
IUPAC Namecis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid
SMILESN[C@H]1C[C@H]1C(=O)O
InChIInChI=1S/C4H7NO2/c5-3-1-2(3)4(6)7/h2-3H,1,5H2,(H,6,7)/t2-,3+/m1/s1
InChIKeyLHKAUBTWBDZARW-GBXIJSLDSA-N
XLogP-0.58
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500101.10
LogP ≤ 5-0.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid (CID 28881824) is cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid is N[C@H]1C[C@H]1C(=O)O.
What is the InChIKey of cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid?
The InChIKey is LHKAUBTWBDZARW-GBXIJSLDSA-N. The full InChI is InChI=1S/C4H7NO2/c5-3-1-2(3)4(6)7/h2-3H,1,5H2,(H,6,7)/t2-,3+/m1/s1.
What are the key properties of cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid?
cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid has a molecular weight of 101.10 g/mol, XLogP of -0.58, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-aminocyclopropane-1-carboxylic acid is sourced from PubChem (CID 28881824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).