About 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one
3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one (PubChem CID 2888291) has the molecular formula C17H21NO4
and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one.
Molecular Properties
| Compound Name | 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one |
| PubChem CID | 2888291 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one |
| SMILES | Cc1ccc2c(c1)C(O)(C1COC(C)(C)CC1=O)C(=O)N2C |
| InChI | InChI=1S/C17H21NO4/c1-10-5-6-13-11(7-10)17(21,15(20)18(13)4)12-9-22-16(2,3)8-14(12)19/h5-7,12,21H,8-9H2,1-4H3 |
| InChIKey | GJFGOBJQPAQOSR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one?
The IUPAC name of 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one (CID 2888291) is 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one.
What is the SMILES notation for 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one?
The canonical SMILES for 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one is Cc1ccc2c(c1)C(O)(C1COC(C)(C)CC1=O)C(=O)N2C.
What is the InChIKey of 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one?
The InChIKey is GJFGOBJQPAQOSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO4/c1-10-5-6-13-11(7-10)17(21,15(20)18(13)4)12-9-22-16(2,3)8-14(12)19/h5-7,12,21H,8-9H2,1-4H3.
What are the key properties of 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one?
3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one has a molecular weight of 303.36 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,6-dimethyl-4-oxooxan-3-yl)-3-hydroxy-1,5-dimethylindol-2-one is sourced from PubChem (CID 2888291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).