C19H30N2O6 — CID 2888407
1-[2-[2-(4-ethylphenoxy)ethoxy]ethyl]-4-methylpiperazine;oxalic acid (PubChem CID 2888407) has the molecular formula C19H30N2O6 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-[2-[2-(4-ethylphenoxy)ethoxy]ethyl]-4-methylpiperazine;oxalic acid.
| Compound Name | 1-[2-[2-(4-ethylphenoxy)ethoxy]ethyl]-4-methylpiperazine;oxalic acid |
|---|---|
| PubChem CID | 2888407 |
| Molecular Formula | C19H30N2O6 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-[2-[2-(4-ethylphenoxy)ethoxy]ethyl]-4-methylpiperazine;oxalic acid |
| SMILES | CCc1ccc(OCCOCCN2CCN(C)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H28N2O2.C2H2O4/c1-3-16-4-6-17(7-5-16)21-15-14-20-13-12-19-10-8-18(2)9-11-19;3-1(4)2(5)6/h4-7H,3,8-15H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | RMFGGQCJWGYPIR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|