C20H34N2O2 — CID 2888578
1-N,3-N-ditert-butyladamantane-1,3-dicarboxamide (PubChem CID 2888578) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is 1-N,3-N-ditert-butyladamantane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-ditert-butyladamantane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 2888578 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | 1-N,3-N-ditert-butyladamantane-1,3-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)C12CC3CC(C1)CC(C(=O)NC(C)(C)C)(C3)C2 |
| InChI | InChI=1S/C20H34N2O2/c1-17(2,3)21-15(23)19-8-13-7-14(9-19)11-20(10-13,12-19)16(24)22-18(4,5)6/h13-14H,7-12H2,1-6H3,(H,21,23)(H,22,24) |
| InChIKey | UCVNRQSDCDXLQO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |