C18H22NO4P — CID 28887382
4-[(R)-(4-methylanilino)-[(2S,4R)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methyl]phenol (PubChem CID 28887382) has the molecular formula C18H22NO4P and a molecular weight of 347.35 g/mol. Its IUPAC name is 4-[(R)-(4-methylanilino)-[(2S,4R)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methyl]phenol.
| Compound Name | 4-[(R)-(4-methylanilino)-[(2S,4R)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methyl]phenol |
|---|---|
| PubChem CID | 28887382 |
| Molecular Formula | C18H22NO4P |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-[(R)-(4-methylanilino)-[(2S,4R)-4-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl]methyl]phenol |
| SMILES | Cc1ccc(N[C@@H](c2ccc(O)cc2)[P@]2(=O)OCC[C@@H](C)O2)cc1 |
| InChI | InChI=1S/C18H22NO4P/c1-13-3-7-16(8-4-13)19-18(15-5-9-17(20)10-6-15)24(21)22-12-11-14(2)23-24/h3-10,14,18-20H,11-12H2,1-2H3/t14-,18-,24+/m1/s1 |
| InChIKey | MVCYMXFPPSIAHN-NLWZSEAUSA-N |
| XLogP | 4.83 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|