About 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate
2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate (PubChem CID 28892) has the molecular formula C18H29NO3
and a molecular weight of 307.43 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate.
Molecular Properties
| Compound Name | 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate |
| PubChem CID | 28892 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate |
| SMILES | CCC(C(=O)OCCOCCN(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C18H29NO3/c1-4-17(16-10-8-7-9-11-16)18(20)22-15-14-21-13-12-19(5-2)6-3/h7-11,17H,4-6,12-15H2,1-3H3 |
| InChIKey | DDVUMDPCZWBYRA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate?
The IUPAC name of 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate (CID 28892) is 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate.
What is the SMILES notation for 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate?
The canonical SMILES for 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate is CCC(C(=O)OCCOCCN(CC)CC)c1ccccc1.
What is the InChIKey of 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate?
The InChIKey is DDVUMDPCZWBYRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO3/c1-4-17(16-10-8-7-9-11-16)18(20)22-15-14-21-13-12-19(5-2)6-3/h7-11,17H,4-6,12-15H2,1-3H3.
What are the key properties of 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate?
2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate has a molecular weight of 307.43 g/mol, XLogP of 3.08, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate is sourced from PubChem (CID 28892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).