C24H16Cl2N2O3S — CID 2889460
2-[[3,5-dichloro-4-(2-phenoxyethoxy)phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 2889460) has the molecular formula C24H16Cl2N2O3S and a molecular weight of 483.38 g/mol. Its IUPAC name is 2-[[3,5-dichloro-4-(2-phenoxyethoxy)phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | 2-[[3,5-dichloro-4-(2-phenoxyethoxy)phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 2889460 |
| Molecular Formula | C24H16Cl2N2O3S |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | 2-[[3,5-dichloro-4-(2-phenoxyethoxy)phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | O=c1c(=Cc2cc(Cl)c(OCCOc3ccccc3)c(Cl)c2)sc2nc3ccccc3n12 |
| InChI | InChI=1S/C24H16Cl2N2O3S/c25-17-12-15(13-18(26)22(17)31-11-10-30-16-6-2-1-3-7-16)14-21-23(29)28-20-9-5-4-8-19(20)27-24(28)32-21/h1-9,12-14H,10-11H2 |
| InChIKey | VGPJCOKNEUTXCR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|