About 2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide
2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide (PubChem CID 2889488) has the molecular formula C17H13ClF5N3O3
and a molecular weight of 437.75 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide.
Molecular Properties
| Compound Name | 2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide |
| PubChem CID | 2889488 |
| Molecular Formula | C17H13ClF5N3O3 |
| Molecular Weight | 437.75 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide |
| SMILES | O=C(NCCCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C17H13ClF5N3O3/c18-11-8-13(20)12(19)7-10(11)16(27)25-5-1-4-24-14-3-2-9(17(21,22)23)6-15(14)26(28)29/h2-3,6-8,24H,1,4-5H2,(H,25,27) |
| InChIKey | JDTZIGISGMVZKK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide?
The IUPAC name of 2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide (CID 2889488) is 2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide.
What is the SMILES notation for 2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide?
The canonical SMILES for 2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide is O=C(NCCCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1cc(F)c(F)cc1Cl.
What is the InChIKey of 2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide?
The InChIKey is JDTZIGISGMVZKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClF5N3O3/c18-11-8-13(20)12(19)7-10(11)16(27)25-5-1-4-24-14-3-2-9(17(21,22)23)6-15(14)26(28)29/h2-3,6-8,24H,1,4-5H2,(H,25,27).
What are the key properties of 2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide?
2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide has a molecular weight of 437.75 g/mol, XLogP of 4.78, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,5-difluoro-N-[3-[2-nitro-4-(trifluoromethyl)anilino]propyl]benzamide is sourced from PubChem (CID 2889488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).