C22H27N3S — CID 28895382
5-[(1S,2R)-2-methylcyclohexyl]-1,3-diphenyl-1,3,5-triazinane-2-thione (PubChem CID 28895382) has the molecular formula C22H27N3S and a molecular weight of 365.55 g/mol. Its IUPAC name is 5-[(1S,2R)-2-methylcyclohexyl]-1,3-diphenyl-1,3,5-triazinane-2-thione.
| Compound Name | 5-[(1S,2R)-2-methylcyclohexyl]-1,3-diphenyl-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 28895382 |
| Molecular Formula | C22H27N3S |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 5-[(1S,2R)-2-methylcyclohexyl]-1,3-diphenyl-1,3,5-triazinane-2-thione |
| SMILES | CC1CCCC[C@@H]1N1CN(c2ccccc2)C(=S)N(c2ccccc2)C1 |
| InChI | InChI=1S/C22H27N3S/c1-18-10-8-9-15-21(18)23-16-24(19-11-4-2-5-12-19)22(26)25(17-23)20-13-6-3-7-14-20/h2-7,11-14,18,21H,8-10,15-17H2,1H3/t18?,21-/m0/s1 |
| InChIKey | XDQUFZGDZXHXFK-ZYZRXSCRSA-N |
| XLogP | 5.09 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|