C11H13NO4 — CID 28897251
2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylazaniumyl)acetate (PubChem CID 28897251) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylazaniumyl)acetate.
| Compound Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylazaniumyl)acetate |
|---|---|
| PubChem CID | 28897251 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylazaniumyl)acetate |
| SMILES | O=C([O-])C[NH2+]c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C11H13NO4/c13-11(14)7-12-8-2-3-9-10(6-8)16-5-1-4-15-9/h2-3,6,12H,1,4-5,7H2,(H,13,14) |
| InChIKey | TZAFQWXMMUQTSA-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|