C19H19N3O3S — CID 28897866
2,2-dimethyl-3-(12-oxo-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-11-yl)propanoic acid (PubChem CID 28897866) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is 2,2-dimethyl-3-(12-oxo-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-11-yl)propanoic acid.
| Compound Name | 2,2-dimethyl-3-(12-oxo-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-11-yl)propanoic acid |
|---|---|
| PubChem CID | 28897866 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2,2-dimethyl-3-(12-oxo-10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-11-yl)propanoic acid |
| SMILES | CC(C)(Cn1c(-c2cccnc2)nc2sc3c(c2c1=O)CCC3)C(=O)O |
| InChI | InChI=1S/C19H19N3O3S/c1-19(2,18(24)25)10-22-15(11-5-4-8-20-9-11)21-16-14(17(22)23)12-6-3-7-13(12)26-16/h4-5,8-9H,3,6-7,10H2,1-2H3,(H,24,25) |
| InChIKey | OXZHXRKTXIDMJW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |